C21H17N7O2 — CID 66503093
methyl 2-(11-benzyl-3-phenyl-1,3,4,7,8,10,12-heptazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl)acetate (PubChem CID 66503093) has the molecular formula C21H17N7O2 and a molecular weight of 399.41 g/mol. Its IUPAC name is methyl 2-(11-benzyl-3-phenyl-1,3,4,7,8,10,12-heptazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl)acetate.
| Compound Name | methyl 2-(11-benzyl-3-phenyl-1,3,4,7,8,10,12-heptazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl)acetate |
|---|---|
| PubChem CID | 66503093 |
| Molecular Formula | C21H17N7O2 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | methyl 2-(11-benzyl-3-phenyl-1,3,4,7,8,10,12-heptazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl)acetate |
| SMILES | COC(=O)Cc1nn(-c2ccccc2)c2c1nnc1nc(Cc3ccccc3)nn12 |
| InChI | InChI=1S/C21H17N7O2/c1-30-18(29)13-16-19-20(27(25-16)15-10-6-3-7-11-15)28-21(24-23-19)22-17(26-28)12-14-8-4-2-5-9-14/h2-11H,12-13H2,1H3 |
| InChIKey | NDELNEOKSBMWBE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 100.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |