C21H14ClFN6O2 — CID 66503267
methyl 2-[10-(4-chlorophenyl)-3-(3-fluorophenyl)-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate (PubChem CID 66503267) has the molecular formula C21H14ClFN6O2 and a molecular weight of 436.83 g/mol. Its IUPAC name is methyl 2-[10-(4-chlorophenyl)-3-(3-fluorophenyl)-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate.
| Compound Name | methyl 2-[10-(4-chlorophenyl)-3-(3-fluorophenyl)-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate |
|---|---|
| PubChem CID | 66503267 |
| Molecular Formula | C21H14ClFN6O2 |
| Molecular Weight | 436.83 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | methyl 2-[10-(4-chlorophenyl)-3-(3-fluorophenyl)-1,3,4,7,8,12-hexazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-5-yl]acetate |
| SMILES | COC(=O)Cc1nn(-c2cccc(F)c2)c2c1nnc1c(-c3ccc(Cl)cc3)cnn12 |
| InChI | InChI=1S/C21H14ClFN6O2/c1-31-18(30)10-17-19-21(28(27-17)15-4-2-3-14(23)9-15)29-20(26-25-19)16(11-24-29)12-5-7-13(22)8-6-12/h2-9,11H,10H2,1H3 |
| InChIKey | IVOAHZGDWDYLIU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.83 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |