C15H14F3N — CID 66512282
(1S)-1-(4-benzylphenyl)-2,2,2-trifluoroethanamine (PubChem CID 66512282) has the molecular formula C15H14F3N and a molecular weight of 265.28 g/mol. Its IUPAC name is (1S)-1-(4-benzylphenyl)-2,2,2-trifluoroethanamine.
| Compound Name | (1S)-1-(4-benzylphenyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 66512282 |
| Molecular Formula | C15H14F3N |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (1S)-1-(4-benzylphenyl)-2,2,2-trifluoroethanamine |
| SMILES | N[C@@H](c1ccc(Cc2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H14F3N/c16-15(17,18)14(19)13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9,14H,10,19H2/t14-/m0/s1 |
| InChIKey | ROLIVWKCDFLXIS-AWEZNQCLSA-N |
| XLogP | 3.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |