C13H15NO6 — CID 66513140
(Z)-5-[4-[amino(carboxy)methyl]phenoxy]-2-hydroxypent-2-enoic acid (PubChem CID 66513140) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is (Z)-5-[4-[amino(carboxy)methyl]phenoxy]-2-hydroxypent-2-enoic acid.
| Compound Name | (Z)-5-[4-[amino(carboxy)methyl]phenoxy]-2-hydroxypent-2-enoic acid |
|---|---|
| PubChem CID | 66513140 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | (Z)-5-[4-[amino(carboxy)methyl]phenoxy]-2-hydroxypent-2-enoic acid |
| SMILES | NC(C(=O)O)c1ccc(OCC/C=C(\O)C(=O)O)cc1 |
| InChI | InChI=1S/C13H15NO6/c14-11(13(18)19)8-3-5-9(6-4-8)20-7-1-2-10(15)12(16)17/h2-6,11,15H,1,7,14H2,(H,16,17)(H,18,19)/b10-2- |
| InChIKey | QZKLSJWVZKWQDS-SGAXSIHGSA-N |
| XLogP | 1.07 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|