C15H24BN3O2 — CID 66521391
2-(3-methylpyrrolidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine (PubChem CID 66521391) has the molecular formula C15H24BN3O2 and a molecular weight of 289.19 g/mol. Its IUPAC name is 2-(3-methylpyrrolidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine.
| Compound Name | 2-(3-methylpyrrolidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine |
|---|---|
| PubChem CID | 66521391 |
| Molecular Formula | C15H24BN3O2 |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 2-(3-methylpyrrolidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine |
| SMILES | CC1CCN(c2cnc(B3OC(C)(C)C(C)(C)O3)cn2)C1 |
| InChI | InChI=1S/C15H24BN3O2/c1-11-6-7-19(10-11)13-9-17-12(8-18-13)16-20-14(2,3)15(4,5)21-16/h8-9,11H,6-7,10H2,1-5H3 |
| InChIKey | OAULRTFNIMJQAC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|