C17H28BN3O2 — CID 163404755
N-methyl-1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]piperidin-4-amine (PubChem CID 163404755) has the molecular formula C17H28BN3O2 and a molecular weight of 317.24 g/mol. Its IUPAC name is N-methyl-1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]piperidin-4-amine.
| Compound Name | N-methyl-1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]piperidin-4-amine |
|---|---|
| PubChem CID | 163404755 |
| Molecular Formula | C17H28BN3O2 |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 317.23 |
| IUPAC Name | N-methyl-1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]piperidin-4-amine |
| SMILES | CNC1CCN(c2ccc(B3OC(C)(C)C(C)(C)O3)nc2)CC1 |
| InChI | InChI=1S/C17H28BN3O2/c1-16(2)17(3,4)23-18(22-16)15-7-6-14(12-20-15)21-10-8-13(19-5)9-11-21/h6-7,12-13,19H,8-11H2,1-5H3 |
| InChIKey | TYOQQPNYSYRESB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|