C21H34BN2O5Si — CID 68548487
CID 68548487 (PubChem CID 68548487) has the molecular formula C21H34BN2O5Si and a molecular weight of 433.41 g/mol.
| Compound Name | CID 68548487 |
|---|---|
| PubChem CID | 68548487 |
| Molecular Formula | C21H34BN2O5Si |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | — |
| SMILES | C[Si](C)O[C@@H](C1CN(c2ccc(B3OC(C)(C)C(C)(C)O3)nc2)C(=O)O1)C(C)(C)C |
| InChI | InChI=1S/C21H34BN2O5Si/c1-19(2,3)17(27-30(8)9)15-13-24(18(25)26-15)14-10-11-16(23-12-14)22-28-20(4,5)21(6,7)29-22/h10-12,15,17H,13H2,1-9H3/t15?,17-/m0/s1 |
| InChIKey | HMVTXVAQCGUKTE-LWKPJOBUSA-N |
| XLogP | 3.39 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|