About CID 68548487
CID 68548487 (PubChem CID 68548487) has the molecular formula C21H34BN2O5Si
and a molecular weight of 433.41 g/mol.
Molecular Properties
| Compound Name | CID 68548487 |
| PubChem CID | 68548487 |
| Molecular Formula | C21H34BN2O5Si |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | — |
| SMILES | C[Si](C)O[C@@H](C1CN(c2ccc(B3OC(C)(C)C(C)(C)O3)nc2)C(=O)O1)C(C)(C)C |
| InChI | InChI=1S/C21H34BN2O5Si/c1-19(2,3)17(27-30(8)9)15-13-24(18(25)26-15)14-10-11-16(23-12-14)22-28-20(4,5)21(6,7)29-22/h10-12,15,17H,13H2,1-9H3/t15?,17-/m0/s1 |
| InChIKey | HMVTXVAQCGUKTE-LWKPJOBUSA-N |
| XLogP | 3.39 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 68548487 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68548487?
The IUPAC name of CID 68548487 (CID 68548487) is not available.
What is the SMILES notation for CID 68548487?
The canonical SMILES for CID 68548487 is C[Si](C)O[C@@H](C1CN(c2ccc(B3OC(C)(C)C(C)(C)O3)nc2)C(=O)O1)C(C)(C)C.
What is the InChIKey of CID 68548487?
The InChIKey is HMVTXVAQCGUKTE-LWKPJOBUSA-N. The full InChI is InChI=1S/C21H34BN2O5Si/c1-19(2,3)17(27-30(8)9)15-13-24(18(25)26-15)14-10-11-16(23-12-14)22-28-20(4,5)21(6,7)29-22/h10-12,15,17H,13H2,1-9H3/t15?,17-/m0/s1.
What are the key properties of CID 68548487?
CID 68548487 has a molecular weight of 433.41 g/mol, XLogP of 3.39, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68548487 is sourced from PubChem (CID 68548487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).