C23H33O8S- — CID 66524612
[(1E,4S,5S,6S,7Z,9Z,11E)-6-hydroxy-1-[(3S)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]-5-methylheptadeca-1,7,9,11-tetraen-4-yl] sulfate (PubChem CID 66524612) has the molecular formula C23H33O8S- and a molecular weight of 469.58 g/mol. Its IUPAC name is [(1E,4S,5S,6S,7Z,9Z,11E)-6-hydroxy-1-[(3S)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]-5-methylheptadeca-1,7,9,11-tetraen-4-yl] sulfate.
| Compound Name | [(1E,4S,5S,6S,7Z,9Z,11E)-6-hydroxy-1-[(3S)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]-5-methylheptadeca-1,7,9,11-tetraen-4-yl] sulfate |
|---|---|
| PubChem CID | 66524612 |
| Molecular Formula | C23H33O8S- |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | [(1E,4S,5S,6S,7Z,9Z,11E)-6-hydroxy-1-[(3S)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]-5-methylheptadeca-1,7,9,11-tetraen-4-yl] sulfate |
| SMILES | CCCCC/C=C/C=C\C=C/[C@H](O)[C@H](C)[C@H](C/C=C/C1OC(=O)C=C[C@@H]1O)OS(=O)(=O)[O-] |
| InChI | InChI=1S/C23H34O8S/c1-3-4-5-6-7-8-9-10-11-13-19(24)18(2)21(31-32(27,28)29)14-12-15-22-20(25)16-17-23(26)30-22/h7-13,15-22,24-25H,3-6,14H2,1-2H3,(H,27,28,29)/p-1/b8-7+,10-9-,13-11-,15-12+/t18-,19-,20-,21-,22?/m0/s1 |
| InChIKey | GGSVZPLREMJSBU-AWVAPUKLSA-M |
| XLogP | 2.87 |
| TPSA | 133.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|