C18H21ClFNO2 — CID 66530787
N-[(2-chloro-5-methoxy-4-propoxyphenyl)methyl]-1-(4-fluorophenyl)methanamine (PubChem CID 66530787) has the molecular formula C18H21ClFNO2 and a molecular weight of 337.82 g/mol. Its IUPAC name is N-[(2-chloro-5-methoxy-4-propoxyphenyl)methyl]-1-(4-fluorophenyl)methanamine.
| Compound Name | N-[(2-chloro-5-methoxy-4-propoxyphenyl)methyl]-1-(4-fluorophenyl)methanamine |
|---|---|
| PubChem CID | 66530787 |
| Molecular Formula | C18H21ClFNO2 |
| Molecular Weight | 337.82 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-[(2-chloro-5-methoxy-4-propoxyphenyl)methyl]-1-(4-fluorophenyl)methanamine |
| SMILES | CCCOc1cc(Cl)c(CNCc2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C18H21ClFNO2/c1-3-8-23-18-10-16(19)14(9-17(18)22-2)12-21-11-13-4-6-15(20)7-5-13/h4-7,9-10,21H,3,8,11-12H2,1-2H3 |
| InChIKey | MKOCAFRNXZYARP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.82 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |