C17H21ClN2O2 — CID 66530872
N-[(2-chloro-5-methoxy-4-propoxyphenyl)methyl]-1-pyridin-4-ylmethanamine (PubChem CID 66530872) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is N-[(2-chloro-5-methoxy-4-propoxyphenyl)methyl]-1-pyridin-4-ylmethanamine.
| Compound Name | N-[(2-chloro-5-methoxy-4-propoxyphenyl)methyl]-1-pyridin-4-ylmethanamine |
|---|---|
| PubChem CID | 66530872 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-[(2-chloro-5-methoxy-4-propoxyphenyl)methyl]-1-pyridin-4-ylmethanamine |
| SMILES | CCCOc1cc(Cl)c(CNCc2ccncc2)cc1OC |
| InChI | InChI=1S/C17H21ClN2O2/c1-3-8-22-17-10-15(18)14(9-16(17)21-2)12-20-11-13-4-6-19-7-5-13/h4-7,9-10,20H,3,8,11-12H2,1-2H3 |
| InChIKey | DLFHWOLQYFIYHK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |