C25H25Cl2FN2O3 — CID 66540032
3-chloro-N-[[2-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-morpholin-4-ylaniline (PubChem CID 66540032) has the molecular formula C25H25Cl2FN2O3 and a molecular weight of 491.39 g/mol. Its IUPAC name is 3-chloro-N-[[2-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-morpholin-4-ylaniline.
| Compound Name | 3-chloro-N-[[2-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 66540032 |
| Molecular Formula | C25H25Cl2FN2O3 |
| Molecular Weight | 491.39 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 3-chloro-N-[[2-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-morpholin-4-ylaniline |
| SMILES | COc1cc(CNc2ccc(N3CCOCC3)c(Cl)c2)c(Cl)cc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C25H25Cl2FN2O3/c1-31-24-12-18(21(26)14-25(24)33-16-17-2-4-19(28)5-3-17)15-29-20-6-7-23(22(27)13-20)30-8-10-32-11-9-30/h2-7,12-14,29H,8-11,15-16H2,1H3 |
| InChIKey | VODAAVUECLTIKK-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.39 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|