C26H28Cl2N2O3 — CID 66542557
N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-morpholin-4-ylaniline (PubChem CID 66542557) has the molecular formula C26H28Cl2N2O3 and a molecular weight of 487.43 g/mol. Its IUPAC name is N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-morpholin-4-ylaniline.
| Compound Name | N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 66542557 |
| Molecular Formula | C26H28Cl2N2O3 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-morpholin-4-ylaniline |
| SMILES | CCOc1cc(CNc2ccc(N3CCOCC3)cc2)c(Cl)cc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H28Cl2N2O3/c1-2-32-25-15-20(24(28)16-26(25)33-18-19-3-5-21(27)6-4-19)17-29-22-7-9-23(10-8-22)30-11-13-31-14-12-30/h3-10,15-16,29H,2,11-14,17-18H2,1H3 |
| InChIKey | LATBRACMLLHZOK-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|