C27H31BrN2O3 — CID 66541145
N-[[2-bromo-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]-4-morpholin-4-ylaniline (PubChem CID 66541145) has the molecular formula C27H31BrN2O3 and a molecular weight of 511.46 g/mol. Its IUPAC name is N-[[2-bromo-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]-4-morpholin-4-ylaniline.
| Compound Name | N-[[2-bromo-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]-4-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 66541145 |
| Molecular Formula | C27H31BrN2O3 |
| Molecular Weight | 511.46 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | N-[[2-bromo-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]-4-morpholin-4-ylaniline |
| SMILES | CCOc1cc(CNc2ccc(N3CCOCC3)cc2)c(Br)cc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C27H31BrN2O3/c1-3-32-26-16-22(25(28)17-27(26)33-19-21-6-4-5-20(2)15-21)18-29-23-7-9-24(10-8-23)30-11-13-31-14-12-30/h4-10,15-17,29H,3,11-14,18-19H2,1-2H3 |
| InChIKey | BVGNMDXBYXOZCA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.46 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|