C27H31ClN2O3 — CID 66540912
N-[[2-chloro-5-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-4-morpholin-4-ylaniline (PubChem CID 66540912) has the molecular formula C27H31ClN2O3 and a molecular weight of 467.01 g/mol. Its IUPAC name is N-[[2-chloro-5-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-4-morpholin-4-ylaniline.
| Compound Name | N-[[2-chloro-5-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-4-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 66540912 |
| Molecular Formula | C27H31ClN2O3 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N-[[2-chloro-5-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-4-morpholin-4-ylaniline |
| SMILES | CCOc1cc(CNc2ccc(N3CCOCC3)cc2)c(Cl)cc1OCc1ccccc1C |
| InChI | InChI=1S/C27H31ClN2O3/c1-3-32-26-16-22(25(28)17-27(26)33-19-21-7-5-4-6-20(21)2)18-29-23-8-10-24(11-9-23)30-12-14-31-15-13-30/h4-11,16-17,29H,3,12-15,18-19H2,1-2H3 |
| InChIKey | VKSOJIJOEWSZNA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|