C22H28Cl2N2O3 — CID 66542123
3-chloro-N-[(2-chloro-5-ethoxy-4-propoxyphenyl)methyl]-4-morpholin-4-ylaniline (PubChem CID 66542123) has the molecular formula C22H28Cl2N2O3 and a molecular weight of 439.38 g/mol. Its IUPAC name is 3-chloro-N-[(2-chloro-5-ethoxy-4-propoxyphenyl)methyl]-4-morpholin-4-ylaniline.
| Compound Name | 3-chloro-N-[(2-chloro-5-ethoxy-4-propoxyphenyl)methyl]-4-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 66542123 |
| Molecular Formula | C22H28Cl2N2O3 |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 3-chloro-N-[(2-chloro-5-ethoxy-4-propoxyphenyl)methyl]-4-morpholin-4-ylaniline |
| SMILES | CCCOc1cc(Cl)c(CNc2ccc(N3CCOCC3)c(Cl)c2)cc1OCC |
| InChI | InChI=1S/C22H28Cl2N2O3/c1-3-9-29-22-14-18(23)16(12-21(22)28-4-2)15-25-17-5-6-20(19(24)13-17)26-7-10-27-11-8-26/h5-6,12-14,25H,3-4,7-11,15H2,1-2H3 |
| InChIKey | CSGJZZRTHNTEMB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|