C18H19BrClNO4 — CID 66542843
5-[(2-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylamino]-2-chlorobenzoic acid (PubChem CID 66542843) has the molecular formula C18H19BrClNO4 and a molecular weight of 428.71 g/mol. Its IUPAC name is 5-[(2-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylamino]-2-chlorobenzoic acid.
| Compound Name | 5-[(2-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylamino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 66542843 |
| Molecular Formula | C18H19BrClNO4 |
| Molecular Weight | 428.71 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 5-[(2-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylamino]-2-chlorobenzoic acid |
| SMILES | COc1cc(CNc2ccc(Cl)c(C(=O)O)c2)c(Br)cc1OC(C)C |
| InChI | InChI=1S/C18H19BrClNO4/c1-10(2)25-17-8-14(19)11(6-16(17)24-3)9-21-12-4-5-15(20)13(7-12)18(22)23/h4-8,10,21H,9H2,1-3H3,(H,22,23) |
| InChIKey | PPVXCXOBYGBSSI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.71 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |