C15H21BrN4O2S — CID 66543492
4-[(6-bromo-3-methoxy-2-propoxyphenyl)methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione (PubChem CID 66543492) has the molecular formula C15H21BrN4O2S and a molecular weight of 401.33 g/mol. Its IUPAC name is 4-[(6-bromo-3-methoxy-2-propoxyphenyl)methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(6-bromo-3-methoxy-2-propoxyphenyl)methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 66543492 |
| Molecular Formula | C15H21BrN4O2S |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 4-[(6-bromo-3-methoxy-2-propoxyphenyl)methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCOc1c(OC)ccc(Br)c1CNn1c(CC)n[nH]c1=S |
| InChI | InChI=1S/C15H21BrN4O2S/c1-4-8-22-14-10(11(16)6-7-12(14)21-3)9-17-20-13(5-2)18-19-15(20)23/h6-7,17H,4-5,8-9H2,1-3H3,(H,19,23) |
| InChIKey | JRVSOAGWDYXTNY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|