C23H30N4O7 — CID 66548860
N-(1,3-benzodioxol-5-yl)-2-[(1S)-1-[[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]amino]-2-methylpropyl]-1,3-oxazole-4-carboxamide (PubChem CID 66548860) has the molecular formula C23H30N4O7 and a molecular weight of 474.51 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[(1S)-1-[[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]amino]-2-methylpropyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[(1S)-1-[[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]amino]-2-methylpropyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 66548860 |
| Molecular Formula | C23H30N4O7 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[(1S)-1-[[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]amino]-2-methylpropyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)N[C@H](c1nc(C(=O)Nc2ccc3c(c2)OCO3)co1)C(C)C |
| InChI | InChI=1S/C23H30N4O7/c1-4-5-6-15(10-27(31)12-28)21(29)26-20(14(2)3)23-25-17(11-32-23)22(30)24-16-7-8-18-19(9-16)34-13-33-18/h7-9,11-12,14-15,20,31H,4-6,10,13H2,1-3H3,(H,24,30)(H,26,29)/t15-,20+/m1/s1 |
| InChIKey | IHBNEZQRWFGSDB-QRWLVFNGSA-N |
| XLogP | 3.12 |
| TPSA | 143.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|