C22H21ClN6O4 — CID 66551459
1-[2-[4-[4-(2-chloro-4-nitrophenyl)piperazine-1-carbonyl]-5-methyltriazol-1-yl]phenyl]ethanone (PubChem CID 66551459) has the molecular formula C22H21ClN6O4 and a molecular weight of 468.90 g/mol. Its IUPAC name is 1-[2-[4-[4-(2-chloro-4-nitrophenyl)piperazine-1-carbonyl]-5-methyltriazol-1-yl]phenyl]ethanone.
| Compound Name | 1-[2-[4-[4-(2-chloro-4-nitrophenyl)piperazine-1-carbonyl]-5-methyltriazol-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 66551459 |
| Molecular Formula | C22H21ClN6O4 |
| Molecular Weight | 468.90 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 1-[2-[4-[4-(2-chloro-4-nitrophenyl)piperazine-1-carbonyl]-5-methyltriazol-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1-n1nnc(C(=O)N2CCN(c3ccc([N+](=O)[O-])cc3Cl)CC2)c1C |
| InChI | InChI=1S/C22H21ClN6O4/c1-14-21(24-25-28(14)19-6-4-3-5-17(19)15(2)30)22(31)27-11-9-26(10-12-27)20-8-7-16(29(32)33)13-18(20)23/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | QXABRXXSZKTUGI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 114.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.90 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|