C20H19ClN6O4 — CID 70688069
[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]-[3-(2-methoxyphenyl)triazol-4-yl]methanone (PubChem CID 70688069) has the molecular formula C20H19ClN6O4 and a molecular weight of 442.86 g/mol. Its IUPAC name is [4-(2-chloro-4-nitrophenyl)piperazin-1-yl]-[3-(2-methoxyphenyl)triazol-4-yl]methanone.
| Compound Name | [4-(2-chloro-4-nitrophenyl)piperazin-1-yl]-[3-(2-methoxyphenyl)triazol-4-yl]methanone |
|---|---|
| PubChem CID | 70688069 |
| Molecular Formula | C20H19ClN6O4 |
| Molecular Weight | 442.86 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | [4-(2-chloro-4-nitrophenyl)piperazin-1-yl]-[3-(2-methoxyphenyl)triazol-4-yl]methanone |
| SMILES | COc1ccccc1-n1nncc1C(=O)N1CCN(c2ccc([N+](=O)[O-])cc2Cl)CC1 |
| InChI | InChI=1S/C20H19ClN6O4/c1-31-19-5-3-2-4-17(19)26-18(13-22-23-26)20(28)25-10-8-24(9-11-25)16-7-6-14(27(29)30)12-15(16)21/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | WDRIQKPEYQONNT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 106.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.86 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|