About 2-thieno[3,2-b]pyridin-2-ylaniline
2-thieno[3,2-b]pyridin-2-ylaniline (PubChem CID 66552620) has the molecular formula C13H10N2S
and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-thieno[3,2-b]pyridin-2-ylaniline.
Molecular Properties
| Compound Name | 2-thieno[3,2-b]pyridin-2-ylaniline |
| PubChem CID | 66552620 |
| Molecular Formula | C13H10N2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2-thieno[3,2-b]pyridin-2-ylaniline |
| SMILES | Nc1ccccc1-c1cc2ncccc2s1 |
| InChI | InChI=1S/C13H10N2S/c14-10-5-2-1-4-9(10)13-8-11-12(16-13)6-3-7-15-11/h1-8H,14H2 |
| InChIKey | ZPLQGQRDAXNBTM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-thieno[3,2-b]pyridin-2-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thieno[3,2-b]pyridin-2-ylaniline?
The IUPAC name of 2-thieno[3,2-b]pyridin-2-ylaniline (CID 66552620) is 2-thieno[3,2-b]pyridin-2-ylaniline.
What is the SMILES notation for 2-thieno[3,2-b]pyridin-2-ylaniline?
The canonical SMILES for 2-thieno[3,2-b]pyridin-2-ylaniline is Nc1ccccc1-c1cc2ncccc2s1.
What is the InChIKey of 2-thieno[3,2-b]pyridin-2-ylaniline?
The InChIKey is ZPLQGQRDAXNBTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2S/c14-10-5-2-1-4-9(10)13-8-11-12(16-13)6-3-7-15-11/h1-8H,14H2.
What are the key properties of 2-thieno[3,2-b]pyridin-2-ylaniline?
2-thieno[3,2-b]pyridin-2-ylaniline has a molecular weight of 226.30 g/mol, XLogP of 3.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thieno[3,2-b]pyridin-2-ylaniline is sourced from PubChem (CID 66552620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).