C14H8N2S2 — CID 153406098
2-thieno[3,2-b]pyridin-2-ylthieno[3,2-b]pyridine (PubChem CID 153406098) has the molecular formula C14H8N2S2 and a molecular weight of 268.37 g/mol. Its IUPAC name is 2-thieno[3,2-b]pyridin-2-ylthieno[3,2-b]pyridine.
| Compound Name | 2-thieno[3,2-b]pyridin-2-ylthieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 153406098 |
| Molecular Formula | C14H8N2S2 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2-thieno[3,2-b]pyridin-2-ylthieno[3,2-b]pyridine |
| SMILES | c1cnc2cc(-c3cc4ncccc4s3)sc2c1 |
| InChI | InChI=1S/C14H8N2S2/c1-3-11-9(15-5-1)7-13(17-11)14-8-10-12(18-14)4-2-6-16-10/h1-8H |
| InChIKey | FOFQBRFECIZOJO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |