About 2-quinolin-2-ylthieno[3,2-b]pyridine
2-quinolin-2-ylthieno[3,2-b]pyridine (PubChem CID 171365776) has the molecular formula C16H10N2S
and a molecular weight of 262.34 g/mol. Its IUPAC name is 2-quinolin-2-ylthieno[3,2-b]pyridine.
Molecular Properties
| Compound Name | 2-quinolin-2-ylthieno[3,2-b]pyridine |
| PubChem CID | 171365776 |
| Molecular Formula | C16H10N2S |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-quinolin-2-ylthieno[3,2-b]pyridine |
| SMILES | c1ccc2nc(-c3cc4ncccc4s3)ccc2c1 |
| InChI | InChI=1S/C16H10N2S/c1-2-5-12-11(4-1)7-8-13(18-12)16-10-14-15(19-16)6-3-9-17-14/h1-10H |
| InChIKey | QWALOULAQQEQBI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-quinolin-2-ylthieno[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-quinolin-2-ylthieno[3,2-b]pyridine?
The IUPAC name of 2-quinolin-2-ylthieno[3,2-b]pyridine (CID 171365776) is 2-quinolin-2-ylthieno[3,2-b]pyridine.
What is the SMILES notation for 2-quinolin-2-ylthieno[3,2-b]pyridine?
The canonical SMILES for 2-quinolin-2-ylthieno[3,2-b]pyridine is c1ccc2nc(-c3cc4ncccc4s3)ccc2c1.
What is the InChIKey of 2-quinolin-2-ylthieno[3,2-b]pyridine?
The InChIKey is QWALOULAQQEQBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2S/c1-2-5-12-11(4-1)7-8-13(18-12)16-10-14-15(19-16)6-3-9-17-14/h1-10H.
What are the key properties of 2-quinolin-2-ylthieno[3,2-b]pyridine?
2-quinolin-2-ylthieno[3,2-b]pyridine has a molecular weight of 262.34 g/mol, XLogP of 4.51, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-quinolin-2-ylthieno[3,2-b]pyridine is sourced from PubChem (CID 171365776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).