C8H8N2S — CID 139437807
N-methylthieno[3,2-b]pyridin-2-amine (PubChem CID 139437807) has the molecular formula C8H8N2S and a molecular weight of 164.23 g/mol. Its IUPAC name is N-methylthieno[3,2-b]pyridin-2-amine.
| Compound Name | N-methylthieno[3,2-b]pyridin-2-amine |
|---|---|
| PubChem CID | 139437807 |
| Molecular Formula | C8H8N2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | N-methylthieno[3,2-b]pyridin-2-amine |
| SMILES | CNc1cc2ncccc2s1 |
| InChI | InChI=1S/C8H8N2S/c1-9-8-5-6-7(11-8)3-2-4-10-6/h2-5,9H,1H3 |
| InChIKey | OQVLEVKXKMPLOW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |