C33H31F3N2O10 — CID 66554956
3-[4-[(1E,6E)-7-(3,4-dimethoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenoxy]-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide (PubChem CID 66554956) has the molecular formula C33H31F3N2O10 and a molecular weight of 672.61 g/mol. Its IUPAC name is 3-[4-[(1E,6E)-7-(3,4-dimethoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenoxy]-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-[4-[(1E,6E)-7-(3,4-dimethoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenoxy]-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 66554956 |
| Molecular Formula | C33H31F3N2O10 |
| Molecular Weight | 672.61 g/mol |
| Exact Mass | 672.19 |
| IUPAC Name | 3-[4-[(1E,6E)-7-(3,4-dimethoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenoxy]-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
| SMILES | COc1ccc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OCC(C)(O)C(=O)Nc3ccc([N+](=O)[O-])c(C(F)(F)F)c3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C33H31F3N2O10/c1-32(42,31(41)37-22-9-12-26(38(43)44)25(17-22)33(34,35)36)19-48-28-14-8-21(16-30(28)47-4)6-11-24(40)18-23(39)10-5-20-7-13-27(45-2)29(15-20)46-3/h5-17,42H,18-19H2,1-4H3,(H,37,41)/b10-5+,11-6+ |
| InChIKey | QJRQTOBXDCTTEN-YOYBCKCWSA-N |
| XLogP | 5.66 |
| TPSA | 163.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|