C22H19FN6O2 — CID 66555051
1-[4-(9-amino-4-oxa-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-3-(2-fluoro-5-methylphenyl)urea (PubChem CID 66555051) has the molecular formula C22H19FN6O2 and a molecular weight of 418.43 g/mol. Its IUPAC name is 1-[4-(9-amino-4-oxa-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-3-(2-fluoro-5-methylphenyl)urea.
| Compound Name | 1-[4-(9-amino-4-oxa-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-3-(2-fluoro-5-methylphenyl)urea |
|---|---|
| PubChem CID | 66555051 |
| Molecular Formula | C22H19FN6O2 |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 1-[4-(9-amino-4-oxa-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-3-(2-fluoro-5-methylphenyl)urea |
| SMILES | Cc1ccc(F)c(NC(=O)Nc2ccc(-n3c4c(c5ncnc(N)c53)COC4)cc2)c1 |
| InChI | InChI=1S/C22H19FN6O2/c1-12-2-7-16(23)17(8-12)28-22(30)27-13-3-5-14(6-4-13)29-18-10-31-9-15(18)19-20(29)21(24)26-11-25-19/h2-8,11H,9-10H2,1H3,(H2,24,25,26)(H2,27,28,30) |
| InChIKey | YPVKZKAJBLVFJB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |