C17H16N4O4 — CID 121265913
2-[4-(9-amino-4-oxa-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]acetic acid (PubChem CID 121265913) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-[4-(9-amino-4-oxa-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]acetic acid.
| Compound Name | 2-[4-(9-amino-4-oxa-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 121265913 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-[4-(9-amino-4-oxa-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]acetic acid |
| SMILES | COc1cc(-n2c3c(c4ncnc(N)c42)COC3)ccc1CC(=O)O |
| InChI | InChI=1S/C17H16N4O4/c1-24-13-5-10(3-2-9(13)4-14(22)23)21-12-7-25-6-11(12)15-16(21)17(18)20-8-19-15/h2-3,5,8H,4,6-7H2,1H3,(H,22,23)(H2,18,19,20) |
| InChIKey | MQOJBWAIRGBVOO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |