C27H26N6O2 — CID 121265797
N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-2-(1-methylindol-5-yl)acetamide (PubChem CID 121265797) has the molecular formula C27H26N6O2 and a molecular weight of 466.55 g/mol. Its IUPAC name is N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-2-(1-methylindol-5-yl)acetamide.
| Compound Name | N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-2-(1-methylindol-5-yl)acetamide |
|---|---|
| PubChem CID | 121265797 |
| Molecular Formula | C27H26N6O2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-2-(1-methylindol-5-yl)acetamide |
| SMILES | COc1cc(-n2c3c(c4ncnc(N)c42)CCC3)ccc1NC(=O)Cc1ccc2c(ccn2C)c1 |
| InChI | InChI=1S/C27H26N6O2/c1-32-11-10-17-12-16(6-9-21(17)32)13-24(34)31-20-8-7-18(14-23(20)35-2)33-22-5-3-4-19(22)25-26(33)27(28)30-15-29-25/h6-12,14-15H,3-5,13H2,1-2H3,(H,31,34)(H2,28,29,30) |
| InChIKey | JWBRDZCNMSPTJK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |