C27H30N6O3 — CID 121265859
2-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-N-[6-(2-methoxypropan-2-yl)-3-pyridinyl]acetamide (PubChem CID 121265859) has the molecular formula C27H30N6O3 and a molecular weight of 486.58 g/mol. Its IUPAC name is 2-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-N-[6-(2-methoxypropan-2-yl)-3-pyridinyl]acetamide.
| Compound Name | 2-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-N-[6-(2-methoxypropan-2-yl)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 121265859 |
| Molecular Formula | C27H30N6O3 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 2-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-N-[6-(2-methoxypropan-2-yl)-3-pyridinyl]acetamide |
| SMILES | COc1cc(-n2c3c(c4ncnc(N)c42)CCC3)ccc1CC(=O)Nc1ccc(C(C)(C)OC)nc1 |
| InChI | InChI=1S/C27H30N6O3/c1-27(2,36-4)22-11-9-17(14-29-22)32-23(34)12-16-8-10-18(13-21(16)35-3)33-20-7-5-6-19(20)24-25(33)26(28)31-15-30-24/h8-11,13-15H,5-7,12H2,1-4H3,(H,32,34)(H2,28,30,31) |
| InChIKey | PYKRJAMAEVLDJQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |