C24H21N7O3 — CID 121265493
2-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-N-(2,1,3-benzoxadiazol-5-yl)acetamide (PubChem CID 121265493) has the molecular formula C24H21N7O3 and a molecular weight of 455.48 g/mol. Its IUPAC name is 2-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-N-(2,1,3-benzoxadiazol-5-yl)acetamide.
| Compound Name | 2-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-N-(2,1,3-benzoxadiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 121265493 |
| Molecular Formula | C24H21N7O3 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 2-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-N-(2,1,3-benzoxadiazol-5-yl)acetamide |
| SMILES | COc1cc(-n2c3c(c4ncnc(N)c42)CCC3)ccc1CC(=O)Nc1ccc2nonc2c1 |
| InChI | InChI=1S/C24H21N7O3/c1-33-20-11-15(31-19-4-2-3-16(19)22-23(31)24(25)27-12-26-22)7-5-13(20)9-21(32)28-14-6-8-17-18(10-14)30-34-29-17/h5-8,10-12H,2-4,9H2,1H3,(H,28,32)(H2,25,26,27) |
| InChIKey | WGYNTVVIISYOIH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 133.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |