C27H26F4N6O2 — CID 145054679
2-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-N-[2-fluoro-5-(trifluoromethyl)phenyl]acetamide;ethanimine (PubChem CID 145054679) has the molecular formula C27H26F4N6O2 and a molecular weight of 542.54 g/mol. Its IUPAC name is 2-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-N-[2-fluoro-5-(trifluoromethyl)phenyl]acetamide;ethanimine.
| Compound Name | 2-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-N-[2-fluoro-5-(trifluoromethyl)phenyl]acetamide;ethanimine |
|---|---|
| PubChem CID | 145054679 |
| Molecular Formula | C27H26F4N6O2 |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 2-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-N-[2-fluoro-5-(trifluoromethyl)phenyl]acetamide;ethanimine |
| SMILES | COc1cc(-n2c3c(c4ncnc(N)c42)CCC3)ccc1CC(=O)Nc1cc(C(F)(F)F)ccc1F.[H]/N=C/C |
| InChI | InChI=1S/C25H21F4N5O2.C2H5N/c1-36-20-11-15(34-19-4-2-3-16(19)22-23(34)24(30)32-12-31-22)7-5-13(20)9-21(35)33-18-10-14(25(27,28)29)6-8-17(18)26;1-2-3/h5-8,10-12H,2-4,9H2,1H3,(H,33,35)(H2,30,31,32);2-3H,1H3/b;3-2+ |
| InChIKey | JXZAQMZPPRYRDQ-ZPYUXNTASA-N |
| XLogP | 5.49 |
| TPSA | 118.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|