C24H21F3N6O2 — CID 121265737
N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-2-[6-(trifluoromethyl)-3-pyridinyl]acetamide (PubChem CID 121265737) has the molecular formula C24H21F3N6O2 and a molecular weight of 482.47 g/mol. Its IUPAC name is N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-2-[6-(trifluoromethyl)-3-pyridinyl]acetamide.
| Compound Name | N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-2-[6-(trifluoromethyl)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 121265737 |
| Molecular Formula | C24H21F3N6O2 |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-methoxyphenyl]-2-[6-(trifluoromethyl)-3-pyridinyl]acetamide |
| SMILES | COc1cc(-n2c3c(c4ncnc(N)c42)CCC3)ccc1NC(=O)Cc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C24H21F3N6O2/c1-35-18-10-14(33-17-4-2-3-15(17)21-22(33)23(28)31-12-30-21)6-7-16(18)32-20(34)9-13-5-8-19(29-11-13)24(25,26)27/h5-8,10-12H,2-4,9H2,1H3,(H,32,34)(H2,28,30,31) |
| InChIKey | CQWVDRLBVLKCNV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |