C27H25F3N6O — CID 121265795
N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-2-[1-(2,2,2-trifluoroethyl)-2,3-dihydroindol-5-yl]acetamide (PubChem CID 121265795) has the molecular formula C27H25F3N6O and a molecular weight of 506.53 g/mol. Its IUPAC name is N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-2-[1-(2,2,2-trifluoroethyl)-2,3-dihydroindol-5-yl]acetamide.
| Compound Name | N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-2-[1-(2,2,2-trifluoroethyl)-2,3-dihydroindol-5-yl]acetamide |
|---|---|
| PubChem CID | 121265795 |
| Molecular Formula | C27H25F3N6O |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-2-[1-(2,2,2-trifluoroethyl)-2,3-dihydroindol-5-yl]acetamide |
| SMILES | Nc1ncnc2c3c(n(-c4ccc(NC(=O)Cc5ccc6c(c5)CCN6CC(F)(F)F)cc4)c12)CCC3 |
| InChI | InChI=1S/C27H25F3N6O/c28-27(29,30)14-35-11-10-17-12-16(4-9-21(17)35)13-23(37)34-18-5-7-19(8-6-18)36-22-3-1-2-20(22)24-25(36)26(31)33-15-32-24/h4-9,12,15H,1-3,10-11,13-14H2,(H,34,37)(H2,31,32,33) |
| InChIKey | APNXXDTZYNCUQW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |