C23H22N6O — CID 121265512
2-amino-N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-2-phenylacetamide (PubChem CID 121265512) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is 2-amino-N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-2-phenylacetamide.
| Compound Name | 2-amino-N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 121265512 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 2-amino-N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-2-phenylacetamide |
| SMILES | Nc1ncnc2c3c(n(-c4ccc(NC(=O)C(N)c5ccccc5)cc4)c12)CCC3 |
| InChI | InChI=1S/C23H22N6O/c24-19(14-5-2-1-3-6-14)23(30)28-15-9-11-16(12-10-15)29-18-8-4-7-17(18)20-21(29)22(25)27-13-26-20/h1-3,5-6,9-13,19H,4,7-8,24H2,(H,28,30)(H2,25,26,27) |
| InChIKey | ACNPXAMFBNISRJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |