C22H20N6O — CID 66556746
1-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-3-phenylurea (PubChem CID 66556746) has the molecular formula C22H20N6O and a molecular weight of 384.44 g/mol. Its IUPAC name is 1-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-3-phenylurea.
| Compound Name | 1-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 66556746 |
| Molecular Formula | C22H20N6O |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-3-phenylurea |
| SMILES | Nc1ncnc2c3c(n(-c4ccc(NC(=O)Nc5ccccc5)cc4)c12)CCC3 |
| InChI | InChI=1S/C22H20N6O/c23-21-20-19(24-13-25-21)17-7-4-8-18(17)28(20)16-11-9-15(10-12-16)27-22(29)26-14-5-2-1-3-6-14/h1-3,5-6,9-13H,4,7-8H2,(H2,23,24,25)(H2,26,27,29) |
| InChIKey | WPZDGSQFLGNKSA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |