C22H22F2N6O2 — CID 145054625
(Z)-N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-6,6-difluoro-5-(methylideneamino)oxyhex-4-enamide (PubChem CID 145054625) has the molecular formula C22H22F2N6O2 and a molecular weight of 440.45 g/mol. Its IUPAC name is (Z)-N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-6,6-difluoro-5-(methylideneamino)oxyhex-4-enamide.
| Compound Name | (Z)-N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-6,6-difluoro-5-(methylideneamino)oxyhex-4-enamide |
|---|---|
| PubChem CID | 145054625 |
| Molecular Formula | C22H22F2N6O2 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (Z)-N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-6,6-difluoro-5-(methylideneamino)oxyhex-4-enamide |
| SMILES | C=NO/C(=C\CCC(=O)Nc1ccc(-n2c3c(c4ncnc(N)c42)CCC3)cc1)C(F)F |
| InChI | InChI=1S/C22H22F2N6O2/c1-26-32-17(21(23)24)6-3-7-18(31)29-13-8-10-14(11-9-13)30-16-5-2-4-15(16)19-20(30)22(25)28-12-27-19/h6,8-12,21H,1-5,7H2,(H,29,31)(H2,25,27,28)/b17-6- |
| InChIKey | DDKUYEZYQOEZDJ-FMQZQXMHSA-N |
| XLogP | 3.99 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|