C27H26N6O — CID 121265898
N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-3-(1-methylindol-3-yl)propanamide (PubChem CID 121265898) has the molecular formula C27H26N6O and a molecular weight of 450.55 g/mol. Its IUPAC name is N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-3-(1-methylindol-3-yl)propanamide.
| Compound Name | N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-3-(1-methylindol-3-yl)propanamide |
|---|---|
| PubChem CID | 121265898 |
| Molecular Formula | C27H26N6O |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]-3-(1-methylindol-3-yl)propanamide |
| SMILES | Cn1cc(CCC(=O)Nc2ccc(-n3c4c(c5ncnc(N)c53)CCC4)cc2)c2ccccc21 |
| InChI | InChI=1S/C27H26N6O/c1-32-15-17(20-5-2-3-7-22(20)32)9-14-24(34)31-18-10-12-19(13-11-18)33-23-8-4-6-21(23)25-26(33)27(28)30-16-29-25/h2-3,5,7,10-13,15-16H,4,6,8-9,14H2,1H3,(H,31,34)(H2,28,29,30) |
| InChIKey | BDLDRSCYGNSLQT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |