C22H19N5O — CID 66556925
N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]benzamide (PubChem CID 66556925) has the molecular formula C22H19N5O and a molecular weight of 369.43 g/mol. Its IUPAC name is N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]benzamide.
| Compound Name | N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 66556925 |
| Molecular Formula | C22H19N5O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)phenyl]benzamide |
| SMILES | Nc1ncnc2c3c(n(-c4ccc(NC(=O)c5ccccc5)cc4)c12)CCC3 |
| InChI | InChI=1S/C22H19N5O/c23-21-20-19(24-13-25-21)17-7-4-8-18(17)27(20)16-11-9-15(10-12-16)26-22(28)14-5-2-1-3-6-14/h1-3,5-6,9-13H,4,7-8H2,(H,26,28)(H2,23,24,25) |
| InChIKey | CZBGTXKZLJWPIB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |