C20H22ClN5O2 — CID 121265710
tert-butyl N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-chlorophenyl]carbamate (PubChem CID 121265710) has the molecular formula C20H22ClN5O2 and a molecular weight of 399.88 g/mol. Its IUPAC name is tert-butyl N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-chlorophenyl]carbamate.
| Compound Name | tert-butyl N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-chlorophenyl]carbamate |
|---|---|
| PubChem CID | 121265710 |
| Molecular Formula | C20H22ClN5O2 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | tert-butyl N-[4-(9-amino-7,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-7-yl)-2-chlorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-n2c3c(c4ncnc(N)c42)CCC3)cc1Cl |
| InChI | InChI=1S/C20H22ClN5O2/c1-20(2,3)28-19(27)25-14-8-7-11(9-13(14)21)26-15-6-4-5-12(15)16-17(26)18(22)24-10-23-16/h7-10H,4-6H2,1-3H3,(H,25,27)(H2,22,23,24) |
| InChIKey | WZUULEDRESPYQR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |