C22H17ClN4 — CID 66555312
(1R,12S,13R)-12-(4-chlorophenyl)-5,6,11,20-tetrazapentacyclo[11.7.0.02,10.03,7.014,19]icosa-2(10),3(7),4,8,14,16,18-heptaene (PubChem CID 66555312) has the molecular formula C22H17ClN4 and a molecular weight of 372.86 g/mol. Its IUPAC name is (1R,12S,13R)-12-(4-chlorophenyl)-5,6,11,20-tetrazapentacyclo[11.7.0.02,10.03,7.014,19]icosa-2(10),3(7),4,8,14,16,18-heptaene.
| Compound Name | (1R,12S,13R)-12-(4-chlorophenyl)-5,6,11,20-tetrazapentacyclo[11.7.0.02,10.03,7.014,19]icosa-2(10),3(7),4,8,14,16,18-heptaene |
|---|---|
| PubChem CID | 66555312 |
| Molecular Formula | C22H17ClN4 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (1R,12S,13R)-12-(4-chlorophenyl)-5,6,11,20-tetrazapentacyclo[11.7.0.02,10.03,7.014,19]icosa-2(10),3(7),4,8,14,16,18-heptaene |
| SMILES | Clc1ccc([C@H]2Nc3ccc4[nH]ncc4c3[C@@H]3Nc4ccccc4[C@H]23)cc1 |
| InChI | InChI=1S/C22H17ClN4/c23-13-7-5-12(6-8-13)21-20-14-3-1-2-4-16(14)25-22(20)19-15-11-24-27-17(15)9-10-18(19)26-21/h1-11,20-22,25-26H,(H,24,27)/t20-,21-,22+/m1/s1 |
| InChIKey | QWNRJESWPNDTBK-VSKRKVRLSA-N |
| XLogP | 5.63 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |