C22H21N5O2S — CID 169279509
(2R,13R,14S,16S,17R)-13-(2-amino-1,3-benzothiazol-6-yl)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraene-16,17-diol (PubChem CID 169279509) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is (2R,13R,14S,16S,17R)-13-(2-amino-1,3-benzothiazol-6-yl)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraene-16,17-diol.
| Compound Name | (2R,13R,14S,16S,17R)-13-(2-amino-1,3-benzothiazol-6-yl)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraene-16,17-diol |
|---|---|
| PubChem CID | 169279509 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (2R,13R,14S,16S,17R)-13-(2-amino-1,3-benzothiazol-6-yl)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraene-16,17-diol |
| SMILES | Nc1nc2ccc([C@@H]3Nc4ccc5[nH]ncc5c4[C@H]4C5CC([C@@H]34)[C@H](O)[C@@H]5O)cc2s1 |
| InChI | InChI=1S/C22H21N5O2S/c23-22-26-13-2-1-8(5-15(13)30-22)19-18-10-6-9(20(28)21(10)29)17(18)16-11-7-24-27-12(11)3-4-14(16)25-19/h1-5,7,9-10,17-21,25,28-29H,6H2,(H2,23,26)(H,24,27)/t9?,10?,17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | RSDATCYUXXOQNV-ASTHMDAISA-N |
| XLogP | 2.99 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |