C24H23N3O2 — CID 170246635
5-[(2R,13R,14S,16S,17R)-16,17-dihydroxy-7,12-diazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]-2-methylbenzonitrile (PubChem CID 170246635) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 5-[(2R,13R,14S,16S,17R)-16,17-dihydroxy-7,12-diazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]-2-methylbenzonitrile.
| Compound Name | 5-[(2R,13R,14S,16S,17R)-16,17-dihydroxy-7,12-diazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 170246635 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 5-[(2R,13R,14S,16S,17R)-16,17-dihydroxy-7,12-diazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]-2-methylbenzonitrile |
| SMILES | Cc1ccc([C@@H]2Nc3ccc4[nH]ccc4c3[C@H]3C4CC([C@@H]23)[C@H](O)[C@@H]4O)cc1C#N |
| InChI | InChI=1S/C24H23N3O2/c1-11-2-3-12(8-13(11)10-25)22-21-16-9-15(23(28)24(16)29)20(21)19-14-6-7-26-17(14)4-5-18(19)27-22/h2-8,15-16,20-24,26-29H,9H2,1H3/t15?,16?,20-,21-,22+,23-,24+/m1/s1 |
| InChIKey | QPKLTRIUVAHJKP-SVBGTWLYSA-N |
| XLogP | 3.59 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |