C23H22N4O3 — CID 169279508
(1R,2R,13R,14S,15S,16S,17R)-16,17-dihydroxy-13-(1H-indazol-5-yl)-7,12-diazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),9-trien-6-one (PubChem CID 169279508) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is (1R,2R,13R,14S,15S,16S,17R)-16,17-dihydroxy-13-(1H-indazol-5-yl)-7,12-diazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),9-trien-6-one.
| Compound Name | (1R,2R,13R,14S,15S,16S,17R)-16,17-dihydroxy-13-(1H-indazol-5-yl)-7,12-diazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),9-trien-6-one |
|---|---|
| PubChem CID | 169279508 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (1R,2R,13R,14S,15S,16S,17R)-16,17-dihydroxy-13-(1H-indazol-5-yl)-7,12-diazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),9-trien-6-one |
| SMILES | O=C1Cc2c(ccc3c2[C@H]2[C@H]4C[C@H]([C@H](O)[C@@H]4O)[C@H]2[C@H](c2ccc4[nH]ncc4c2)N3)N1 |
| InChI | InChI=1S/C23H22N4O3/c28-17-7-11-15(25-17)3-4-16-18(11)19-12-6-13(23(30)22(12)29)20(19)21(26-16)9-1-2-14-10(5-9)8-24-27-14/h1-5,8,12-13,19-23,26,29-30H,6-7H2,(H,24,27)(H,25,28)/t12-,13+,19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | KECGOBKXGRRQAA-XWVPJGJESA-N |
| XLogP | 2.30 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |