C23H20FN3O2 — CID 166924117
5-[(2R,14S,16S)-16,17-dihydroxy-7,12-diazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]-2-fluorobenzonitrile (PubChem CID 166924117) has the molecular formula C23H20FN3O2 and a molecular weight of 389.43 g/mol. Its IUPAC name is 5-[(2R,14S,16S)-16,17-dihydroxy-7,12-diazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]-2-fluorobenzonitrile.
| Compound Name | 5-[(2R,14S,16S)-16,17-dihydroxy-7,12-diazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 166924117 |
| Molecular Formula | C23H20FN3O2 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 5-[(2R,14S,16S)-16,17-dihydroxy-7,12-diazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-13-yl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(C2Nc3ccc4[nH]ccc4c3[C@H]3C4CC([C@H](O)C4O)[C@@H]23)ccc1F |
| InChI | InChI=1S/C23H20FN3O2/c24-15-2-1-10(7-11(15)9-25)21-20-14-8-13(22(28)23(14)29)19(20)18-12-5-6-26-16(12)3-4-17(18)27-21/h1-7,13-14,19-23,26-29H,8H2/t13?,14?,19-,20-,21?,22?,23+/m1/s1 |
| InChIKey | ACEOOAWQAGXNSI-YKVAQOJLSA-N |
| XLogP | 3.42 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |