C24H25N5OS — CID 169279412
2-[(2S,13R,14R)-13-(2-amino-1,3-benzothiazol-6-yl)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-7-yl]ethanol (PubChem CID 169279412) has the molecular formula C24H25N5OS and a molecular weight of 431.57 g/mol. Its IUPAC name is 2-[(2S,13R,14R)-13-(2-amino-1,3-benzothiazol-6-yl)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-7-yl]ethanol.
| Compound Name | 2-[(2S,13R,14R)-13-(2-amino-1,3-benzothiazol-6-yl)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-7-yl]ethanol |
|---|---|
| PubChem CID | 169279412 |
| Molecular Formula | C24H25N5OS |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 2-[(2S,13R,14R)-13-(2-amino-1,3-benzothiazol-6-yl)-6,7,12-triazapentacyclo[13.2.1.02,14.03,11.04,8]octadeca-3(11),4(8),5,9-tetraen-7-yl]ethanol |
| SMILES | Nc1nc2ccc([C@@H]3Nc4ccc5c(cnn5CCO)c4[C@H]4C5CCC(C5)[C@@H]34)cc2s1 |
| InChI | InChI=1S/C24H25N5OS/c25-24-28-16-4-3-14(10-19(16)31-24)23-21-13-2-1-12(9-13)20(21)22-15-11-26-29(7-8-30)18(15)6-5-17(22)27-23/h3-6,10-13,20-21,23,27,30H,1-2,7-9H2,(H2,25,28)/t12?,13?,20-,21+,23-/m0/s1 |
| InChIKey | RZSDDIIEEPGIMA-PPGGPJAGSA-N |
| XLogP | 4.52 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |