C21H22N6O2S2 — CID 169279398
6-[(4aS,5S,11cS)-1-methylsulfonyl-2,3,4,4a,5,6,9,11c-octahydroindazolo[5,4-h][1,6]naphthyridin-5-yl]-1,3-benzothiazol-2-amine (PubChem CID 169279398) has the molecular formula C21H22N6O2S2 and a molecular weight of 454.58 g/mol. Its IUPAC name is 6-[(4aS,5S,11cS)-1-methylsulfonyl-2,3,4,4a,5,6,9,11c-octahydroindazolo[5,4-h][1,6]naphthyridin-5-yl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-[(4aS,5S,11cS)-1-methylsulfonyl-2,3,4,4a,5,6,9,11c-octahydroindazolo[5,4-h][1,6]naphthyridin-5-yl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 169279398 |
| Molecular Formula | C21H22N6O2S2 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 6-[(4aS,5S,11cS)-1-methylsulfonyl-2,3,4,4a,5,6,9,11c-octahydroindazolo[5,4-h][1,6]naphthyridin-5-yl]-1,3-benzothiazol-2-amine |
| SMILES | CS(=O)(=O)N1CCC[C@H]2[C@@H](c3ccc4nc(N)sc4c3)Nc3ccc4[nH]ncc4c3[C@H]21 |
| InChI | InChI=1S/C21H22N6O2S2/c1-31(28,29)27-8-2-3-12-19(11-4-5-15-17(9-11)30-21(22)25-15)24-16-7-6-14-13(10-23-26-14)18(16)20(12)27/h4-7,9-10,12,19-20,24H,2-3,8H2,1H3,(H2,22,25)(H,23,26)/t12-,19+,20-/m0/s1 |
| InChIKey | WMMVZGAUUQMKOL-KNMUDHKVSA-N |
| XLogP | 3.63 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |