About 7-amino-2-[[(7-amino-2-carboxyheptyl)diselanyl]methyl]heptanoic acid;dihydrochloride
7-amino-2-[[(7-amino-2-carboxyheptyl)diselanyl]methyl]heptanoic acid;dihydrochloride (PubChem CID 66563347) has the molecular formula C16H34Cl2N2O4Se2
and a molecular weight of 547.28 g/mol. Its IUPAC name is 7-amino-2-[[(7-amino-2-carboxyheptyl)diselanyl]methyl]heptanoic acid;dihydrochloride.
Molecular Properties
| Compound Name | 7-amino-2-[[(7-amino-2-carboxyheptyl)diselanyl]methyl]heptanoic acid;dihydrochloride |
| PubChem CID | 66563347 |
| Molecular Formula | C16H34Cl2N2O4Se2 |
| Molecular Weight | 547.28 g/mol |
| Exact Mass | 548.02 |
| IUPAC Name | 7-amino-2-[[(7-amino-2-carboxyheptyl)diselanyl]methyl]heptanoic acid;dihydrochloride |
| SMILES | Cl.Cl.NCCCCCC(C[Se][Se]CC(CCCCCN)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H32N2O4Se2.2ClH/c17-9-5-1-3-7-13(15(19)20)11-23-24-12-14(16(21)22)8-4-2-6-10-18;;/h13-14H,1-12,17-18H2,(H,19,20)(H,21,22);2*1H |
| InChIKey | ZXBJECXHRPNKFB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 547.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-2-[[(7-amino-2-carboxyheptyl)diselanyl]methyl]heptanoic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-2-[[(7-amino-2-carboxyheptyl)diselanyl]methyl]heptanoic acid;dihydrochloride?
The IUPAC name of 7-amino-2-[[(7-amino-2-carboxyheptyl)diselanyl]methyl]heptanoic acid;dihydrochloride (CID 66563347) is 7-amino-2-[[(7-amino-2-carboxyheptyl)diselanyl]methyl]heptanoic acid;dihydrochloride.
What is the SMILES notation for 7-amino-2-[[(7-amino-2-carboxyheptyl)diselanyl]methyl]heptanoic acid;dihydrochloride?
The canonical SMILES for 7-amino-2-[[(7-amino-2-carboxyheptyl)diselanyl]methyl]heptanoic acid;dihydrochloride is Cl.Cl.NCCCCCC(C[Se][Se]CC(CCCCCN)C(=O)O)C(=O)O.
What is the InChIKey of 7-amino-2-[[(7-amino-2-carboxyheptyl)diselanyl]methyl]heptanoic acid;dihydrochloride?
The InChIKey is ZXBJECXHRPNKFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2O4Se2.2ClH/c17-9-5-1-3-7-13(15(19)20)11-23-24-12-14(16(21)22)8-4-2-6-10-18;;/h13-14H,1-12,17-18H2,(H,19,20)(H,21,22);2*1H.
What are the key properties of 7-amino-2-[[(7-amino-2-carboxyheptyl)diselanyl]methyl]heptanoic acid;dihydrochloride?
7-amino-2-[[(7-amino-2-carboxyheptyl)diselanyl]methyl]heptanoic acid;dihydrochloride has a molecular weight of 547.28 g/mol, XLogP of 2.43, 17 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-2-[[(7-amino-2-carboxyheptyl)diselanyl]methyl]heptanoic acid;dihydrochloride is sourced from PubChem (CID 66563347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).