C21H28N2O — CID 66574323
(4aS,4bR,10aR,10bS,12aS)-1,10a,12a-trimethyl-2-oxo-3,4,4a,4b,5,9,10,10b,11,12-decahydronaphtho[2,1-f]quinoline-8-carbonitrile (PubChem CID 66574323) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is (4aS,4bR,10aR,10bS,12aS)-1,10a,12a-trimethyl-2-oxo-3,4,4a,4b,5,9,10,10b,11,12-decahydronaphtho[2,1-f]quinoline-8-carbonitrile.
| Compound Name | (4aS,4bR,10aR,10bS,12aS)-1,10a,12a-trimethyl-2-oxo-3,4,4a,4b,5,9,10,10b,11,12-decahydronaphtho[2,1-f]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 66574323 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | (4aS,4bR,10aR,10bS,12aS)-1,10a,12a-trimethyl-2-oxo-3,4,4a,4b,5,9,10,10b,11,12-decahydronaphtho[2,1-f]quinoline-8-carbonitrile |
| SMILES | CN1C(=O)CC[C@H]2[C@@H]3CC=C4C=C(C#N)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C21H28N2O/c1-20-10-8-14(13-22)12-15(20)4-5-16-17(20)9-11-21(2)18(16)6-7-19(24)23(21)3/h4,12,16-18H,5-11H2,1-3H3/t16-,17+,18+,20+,21+/m1/s1 |
| InChIKey | GDFGKYRSIUMPCQ-JOTVOLILSA-N |
| XLogP | 4.22 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |