C17H20N2O4S2 — CID 66581095
ethyl 3-cyclohexyl-8,8-dioxo-8λ6,10-dithia-3,4-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,11-tetraene-5-carboxylate (PubChem CID 66581095) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is ethyl 3-cyclohexyl-8,8-dioxo-8λ6,10-dithia-3,4-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,11-tetraene-5-carboxylate.
| Compound Name | ethyl 3-cyclohexyl-8,8-dioxo-8λ6,10-dithia-3,4-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,11-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 66581095 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | ethyl 3-cyclohexyl-8,8-dioxo-8λ6,10-dithia-3,4-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,11-tetraene-5-carboxylate |
| SMILES | CCOC(=O)c1nn(C2CCCCC2)c2c1CS(=O)(=O)c1sccc1-2 |
| InChI | InChI=1S/C17H20N2O4S2/c1-2-23-16(20)14-13-10-25(21,22)17-12(8-9-24-17)15(13)19(18-14)11-6-4-3-5-7-11/h8-9,11H,2-7,10H2,1H3 |
| InChIKey | YWCRRKGVPAJKQD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |