C37H55IN6O6Si2 — CID 66583834
4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-iodo-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylic acid (PubChem CID 66583834) has the molecular formula C37H55IN6O6Si2 and a molecular weight of 862.96 g/mol. Its IUPAC name is 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-iodo-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylic acid.
| Compound Name | 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-iodo-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 66583834 |
| Molecular Formula | C37H55IN6O6Si2 |
| Molecular Weight | 862.96 g/mol |
| Exact Mass | 862.28 |
| IUPAC Name | 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-iodo-3-(1-phenylpyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-(2-methoxyethoxy)cyclohexane-1-carboxylic acid |
| SMILES | COCCOC1(C(=O)O)CCC(c2nc3c(-c4cnn(-c5ccccc5)c4)cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c2I)CC1 |
| InChI | InChI=1S/C37H55IN6O6Si2/c1-47-17-18-50-37(36(45)46)15-13-28(14-16-37)33-32(38)35(42(26-48-19-21-51(2,3)4)27-49-20-22-52(5,6)7)44-34(41-33)31(24-40-44)29-23-39-43(25-29)30-11-9-8-10-12-30/h8-12,23-25,28H,13-22,26-27H2,1-7H3,(H,45,46) |
| InChIKey | SDKGPYUTLYLVMO-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.96 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|